C21H33BN2O5 — CID 170809698
tert-butyl N-[3-(3-amino-4-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809698) has the molecular formula C21H33BN2O5 and a molecular weight of 404.32 g/mol. Its IUPAC name is tert-butyl N-[3-(3-amino-4-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-amino-4-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809698 |
| Molecular Formula | C21H33BN2O5 |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | tert-butyl N-[3-(3-amino-4-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COc1ccc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)cc1N |
| InChI | InChI=1S/C21H33BN2O5/c1-19(2,3)27-18(25)24-13-15(22-28-20(4,5)21(6,7)29-22)11-14-9-10-17(26-8)16(23)12-14/h9-12H,13,23H2,1-8H3,(H,24,25) |
| InChIKey | YDUCJOSKJUNHEQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|