C24H33BN2O5 — CID 170810304
tert-butyl N-[3-(2-methoxyquinolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810304) has the molecular formula C24H33BN2O5 and a molecular weight of 440.35 g/mol. Its IUPAC name is tert-butyl N-[3-(2-methoxyquinolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-methoxyquinolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810304 |
| Molecular Formula | C24H33BN2O5 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | tert-butyl N-[3-(2-methoxyquinolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COc1ccc2cc(C=C(CNC(=O)OC(C)(C)C)B3OC(C)(C)C(C)(C)O3)ccc2n1 |
| InChI | InChI=1S/C24H33BN2O5/c1-22(2,3)30-21(28)26-15-18(25-31-23(4,5)24(6,7)32-25)14-16-9-11-19-17(13-16)10-12-20(27-19)29-8/h9-14H,15H2,1-8H3,(H,26,28) |
| InChIKey | DNQUTSVTCHMAIX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|