C26H35BN2O5 — CID 170810454
tert-butyl N-[3-[4-(4-aminophenoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810454) has the molecular formula C26H35BN2O5 and a molecular weight of 466.39 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(4-aminophenoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(4-aminophenoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810454 |
| Molecular Formula | C26H35BN2O5 |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | tert-butyl N-[3-[4-(4-aminophenoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(Oc2ccc(N)cc2)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H35BN2O5/c1-24(2,3)32-23(30)29-17-19(27-33-25(4,5)26(6,7)34-27)16-18-8-12-21(13-9-18)31-22-14-10-20(28)11-15-22/h8-16H,17,28H2,1-7H3,(H,29,30) |
| InChIKey | LBLKDBXYQUARFX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|