C22H32BClN2O5 — CID 170810186
tert-butyl N-[3-[4-[(2-chloroacetyl)amino]phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810186) has the molecular formula C22H32BClN2O5 and a molecular weight of 450.77 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[(2-chloroacetyl)amino]phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[(2-chloroacetyl)amino]phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810186 |
| Molecular Formula | C22H32BClN2O5 |
| Molecular Weight | 450.77 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | tert-butyl N-[3-[4-[(2-chloroacetyl)amino]phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(NC(=O)CCl)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H32BClN2O5/c1-20(2,3)29-19(28)25-14-16(23-30-21(4,5)22(6,7)31-23)12-15-8-10-17(11-9-15)26-18(27)13-24/h8-12H,13-14H2,1-7H3,(H,25,28)(H,26,27) |
| InChIKey | SRYFKNOKJXRUEE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.77 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|