C24H27BF3NO5 — CID 170813365
benzyl N-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813365) has the molecular formula C24H27BF3NO5 and a molecular weight of 477.29 g/mol. Its IUPAC name is benzyl N-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813365 |
| Molecular Formula | C24H27BF3NO5 |
| Molecular Weight | 477.29 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | benzyl N-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cc(C(F)(F)F)ccc2O)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H27BF3NO5/c1-22(2)23(3,4)34-25(33-22)19(13-17-12-18(24(26,27)28)10-11-20(17)30)14-29-21(31)32-15-16-8-6-5-7-9-16/h5-13,30H,14-15H2,1-4H3,(H,29,31) |
| InChIKey | GLYNQGFKSGSSCP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.29 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|