C23H25BF3NO4 — CID 170812658
benzyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,5-trifluorophenyl)prop-2-enyl]carbamate (PubChem CID 170812658) has the molecular formula C23H25BF3NO4 and a molecular weight of 447.26 g/mol. Its IUPAC name is benzyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,5-trifluorophenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,5-trifluorophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812658 |
| Molecular Formula | C23H25BF3NO4 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | benzyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,5-trifluorophenyl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cc(F)c(F)cc2F)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C23H25BF3NO4/c1-22(2)23(3,4)32-24(31-22)17(10-16-11-19(26)20(27)12-18(16)25)13-28-21(29)30-14-15-8-6-5-7-9-15/h5-12H,13-14H2,1-4H3,(H,28,29) |
| InChIKey | VSMAHLZSTOHEFH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|