C25H29BFNO5 — CID 170813158
benzyl N-[3-(3-acetyl-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813158) has the molecular formula C25H29BFNO5 and a molecular weight of 453.32 g/mol. Its IUPAC name is benzyl N-[3-(3-acetyl-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-acetyl-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813158 |
| Molecular Formula | C25H29BFNO5 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | benzyl N-[3-(3-acetyl-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(=O)c1cccc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C25H29BFNO5/c1-17(29)21-13-9-12-19(22(21)27)14-20(26-32-24(2,3)25(4,5)33-26)15-28-23(30)31-16-18-10-7-6-8-11-18/h6-14H,15-16H2,1-5H3,(H,28,30) |
| InChIKey | PYOUSZWRVLJRIV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|