C29H33BN2O4 — CID 170813677
benzyl N-[3-(2-anilinophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813677) has the molecular formula C29H33BN2O4 and a molecular weight of 484.41 g/mol. Its IUPAC name is benzyl N-[3-(2-anilinophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2-anilinophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813677 |
| Molecular Formula | C29H33BN2O4 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | benzyl N-[3-(2-anilinophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccccc2Nc2ccccc2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C29H33BN2O4/c1-28(2)29(3,4)36-30(35-28)24(20-31-27(33)34-21-22-13-7-5-8-14-22)19-23-15-11-12-18-26(23)32-25-16-9-6-10-17-25/h5-19,32H,20-21H2,1-4H3,(H,31,33) |
| InChIKey | MIRSXQUPZWATNB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|