C27H34BNO6 — CID 170813584
methyl 3-[2-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]propanoate (PubChem CID 170813584) has the molecular formula C27H34BNO6 and a molecular weight of 479.38 g/mol. Its IUPAC name is methyl 3-[2-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]propanoate.
| Compound Name | methyl 3-[2-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]propanoate |
|---|---|
| PubChem CID | 170813584 |
| Molecular Formula | C27H34BNO6 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | methyl 3-[2-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccccc1C=C(CNC(=O)OCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H34BNO6/c1-26(2)27(3,4)35-28(34-26)23(18-29-25(31)33-19-20-11-7-6-8-12-20)17-22-14-10-9-13-21(22)15-16-24(30)32-5/h6-14,17H,15-16,18-19H2,1-5H3,(H,29,31) |
| InChIKey | POAXBOIQLJLBDU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|