C24H30BN3O4S — CID 170813198
benzyl N-[3-[2-(carbamothioylamino)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813198) has the molecular formula C24H30BN3O4S and a molecular weight of 467.40 g/mol. Its IUPAC name is benzyl N-[3-[2-(carbamothioylamino)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[2-(carbamothioylamino)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813198 |
| Molecular Formula | C24H30BN3O4S |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | benzyl N-[3-[2-(carbamothioylamino)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccccc2NC(N)=S)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H30BN3O4S/c1-23(2)24(3,4)32-25(31-23)19(14-18-12-8-9-13-20(18)28-21(26)33)15-27-22(29)30-16-17-10-6-5-7-11-17/h5-14H,15-16H2,1-4H3,(H,27,29)(H3,26,28,33) |
| InChIKey | IBRLAROSQKRBGX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|