C22H32BNO7 — CID 170810131
tert-butyl N-[3-(3-formyl-4-hydroxy-5-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810131) has the molecular formula C22H32BNO7 and a molecular weight of 433.31 g/mol. Its IUPAC name is tert-butyl N-[3-(3-formyl-4-hydroxy-5-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-formyl-4-hydroxy-5-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810131 |
| Molecular Formula | C22H32BNO7 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | tert-butyl N-[3-(3-formyl-4-hydroxy-5-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COc1cc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)cc(C=O)c1O |
| InChI | InChI=1S/C22H32BNO7/c1-20(2,3)29-19(27)24-12-16(23-30-21(4,5)22(6,7)31-23)10-14-9-15(13-25)18(26)17(11-14)28-8/h9-11,13,26H,12H2,1-8H3,(H,24,27) |
| InChIKey | YVDMKVNOWARCIV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|