C19H28BNO5S — CID 170809018
tert-butyl N-[3-(5-formylthiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809018) has the molecular formula C19H28BNO5S and a molecular weight of 393.31 g/mol. Its IUPAC name is tert-butyl N-[3-(5-formylthiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-formylthiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809018 |
| Molecular Formula | C19H28BNO5S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | tert-butyl N-[3-(5-formylthiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1csc(C=O)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H28BNO5S/c1-17(2,3)24-16(23)21-10-14(8-13-9-15(11-22)27-12-13)20-25-18(4,5)19(6,7)26-20/h8-9,11-12H,10H2,1-7H3,(H,21,23) |
| InChIKey | MPMARXAVJKZOQJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|