C21H32BNO6S — CID 170809763
tert-butyl N-[3-[5-(1,3-dioxolan-2-yl)thiophen-3-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809763) has the molecular formula C21H32BNO6S and a molecular weight of 437.37 g/mol. Its IUPAC name is tert-butyl N-[3-[5-(1,3-dioxolan-2-yl)thiophen-3-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-(1,3-dioxolan-2-yl)thiophen-3-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809763 |
| Molecular Formula | C21H32BNO6S |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | tert-butyl N-[3-[5-(1,3-dioxolan-2-yl)thiophen-3-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1csc(C2OCCO2)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H32BNO6S/c1-19(2,3)27-18(24)23-12-15(22-28-20(4,5)21(6,7)29-22)10-14-11-16(30-13-14)17-25-8-9-26-17/h10-11,13,17H,8-9,12H2,1-7H3,(H,23,24) |
| InChIKey | HICQNPACZBPSBH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|