C22H31BN2O6 — CID 170810255
tert-butyl N-[3-(3-oxo-4H-1,4-benzoxazin-7-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810255) has the molecular formula C22H31BN2O6 and a molecular weight of 430.31 g/mol. Its IUPAC name is tert-butyl N-[3-(3-oxo-4H-1,4-benzoxazin-7-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-oxo-4H-1,4-benzoxazin-7-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810255 |
| Molecular Formula | C22H31BN2O6 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | tert-butyl N-[3-(3-oxo-4H-1,4-benzoxazin-7-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc2c(c1)OCC(=O)N2)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H31BN2O6/c1-20(2,3)29-19(27)24-12-15(23-30-21(4,5)22(6,7)31-23)10-14-8-9-16-17(11-14)28-13-18(26)25-16/h8-11H,12-13H2,1-7H3,(H,24,27)(H,25,26) |
| InChIKey | WSWUIGZFINQWRT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|