C22H29BN2O6 — CID 170810251
tert-butyl N-[3-(2,3-dioxo-1H-indol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810251) has the molecular formula C22H29BN2O6 and a molecular weight of 428.29 g/mol. Its IUPAC name is tert-butyl N-[3-(2,3-dioxo-1H-indol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,3-dioxo-1H-indol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810251 |
| Molecular Formula | C22H29BN2O6 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl N-[3-(2,3-dioxo-1H-indol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc2c(c1)C(=O)C(=O)N2)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H29BN2O6/c1-20(2,3)29-19(28)24-12-14(23-30-21(4,5)22(6,7)31-23)10-13-8-9-16-15(11-13)17(26)18(27)25-16/h8-11H,12H2,1-7H3,(H,24,28)(H,25,26,27) |
| InChIKey | GIUJCZVISUPJCN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|