C16H27BN4O4 — CID 170808978
tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]carbamate (PubChem CID 170808978) has the molecular formula C16H27BN4O4 and a molecular weight of 350.23 g/mol. Its IUPAC name is tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170808978 |
| Molecular Formula | C16H27BN4O4 |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ncn[nH]1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H27BN4O4/c1-14(2,3)23-13(22)18-9-11(8-12-19-10-20-21-12)17-24-15(4,5)16(6,7)25-17/h8,10H,9H2,1-7H3,(H,18,22)(H,19,20,21) |
| InChIKey | BCDNPXKAOUEJEM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|