C19H31BN2O4S — CID 170809068
tert-butyl N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809068) has the molecular formula C19H31BN2O4S and a molecular weight of 394.35 g/mol. Its IUPAC name is tert-butyl N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809068 |
| Molecular Formula | C19H31BN2O4S |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1nc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)sc1C |
| InChI | InChI=1S/C19H31BN2O4S/c1-12-13(2)27-15(22-12)10-14(11-21-16(23)24-17(3,4)5)20-25-18(6,7)19(8,9)26-20/h10H,11H2,1-9H3,(H,21,23) |
| InChIKey | CLFNQEXKGVHGNB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|