C15H24BN3O4 — CID 170806692
3-(2,4-dimethoxypyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170806692) has the molecular formula C15H24BN3O4 and a molecular weight of 321.19 g/mol. Its IUPAC name is 3-(2,4-dimethoxypyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(2,4-dimethoxypyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170806692 |
| Molecular Formula | C15H24BN3O4 |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-(2,4-dimethoxypyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | COc1ncc(C=C(CN)B2OC(C)(C)C(C)(C)O2)c(OC)n1 |
| InChI | InChI=1S/C15H24BN3O4/c1-14(2)15(3,4)23-16(22-14)11(8-17)7-10-9-18-13(21-6)19-12(10)20-5/h7,9H,8,17H2,1-6H3 |
| InChIKey | LWYQXNHMGOSIPT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|