C15H21BN2O4S — CID 170807460
N-[3-(4-formyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807460) has the molecular formula C15H21BN2O4S and a molecular weight of 336.22 g/mol. Its IUPAC name is N-[3-(4-formyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(4-formyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807460 |
| Molecular Formula | C15H21BN2O4S |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[3-(4-formyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1nc(C=O)cs1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H21BN2O4S/c1-10(20)17-7-11(6-13-18-12(8-19)9-23-13)16-21-14(2,3)15(4,5)22-16/h6,8-9H,7H2,1-5H3,(H,17,20) |
| InChIKey | MXBXDNPHUVBUML-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|