C18H29BN2O6S2 — CID 170809676
tert-butyl N-[3-(5-sulfamoylthiophen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809676) has the molecular formula C18H29BN2O6S2 and a molecular weight of 444.38 g/mol. Its IUPAC name is tert-butyl N-[3-(5-sulfamoylthiophen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-sulfamoylthiophen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809676 |
| Molecular Formula | C18H29BN2O6S2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | tert-butyl N-[3-(5-sulfamoylthiophen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(S(N)(=O)=O)s1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H29BN2O6S2/c1-16(2,3)25-15(22)21-11-12(19-26-17(4,5)18(6,7)27-19)10-13-8-9-14(28-13)29(20,23)24/h8-10H,11H2,1-7H3,(H,21,22)(H2,20,23,24) |
| InChIKey | KOQQTFJGFLLGAQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|