C16H23BN2O3 — CID 170814261
3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-4-carbaldehyde (PubChem CID 170814261) has the molecular formula C16H23BN2O3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-4-carbaldehyde.
| Compound Name | 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 170814261 |
| Molecular Formula | C16H23BN2O3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-4-carbaldehyde |
| SMILES | CNCC(=Cc1cnccc1C=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H23BN2O3/c1-15(2)16(3,4)22-17(21-15)14(10-18-5)8-13-9-19-7-6-12(13)11-20/h6-9,11,18H,10H2,1-5H3 |
| InChIKey | YZFWLTFAYJOWGD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|