C18H22BNO4S — CID 170803786
5-methyl-4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione (PubChem CID 170803786) has the molecular formula C18H22BNO4S and a molecular weight of 359.26 g/mol. Its IUPAC name is 5-methyl-4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione.
| Compound Name | 5-methyl-4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 170803786 |
| Molecular Formula | C18H22BNO4S |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-methyl-4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione |
| SMILES | Cc1ccc2c(c1C=C(CS)B1OC(C)(C)C(C)(C)O1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C18H22BNO4S/c1-10-6-7-13-14(15(21)16(22)20-13)12(10)8-11(9-25)19-23-17(2,3)18(4,5)24-19/h6-8,25H,9H2,1-5H3,(H,20,21,22) |
| InChIKey | AVNYWAWFNRQBPS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|