C17H23BO4S — CID 170803345
3-methyl-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170803345) has the molecular formula C17H23BO4S and a molecular weight of 334.25 g/mol. Its IUPAC name is 3-methyl-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 3-methyl-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170803345 |
| Molecular Formula | C17H23BO4S |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-methyl-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1C=C(CS)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BO4S/c1-11-7-6-8-13(15(19)20)14(11)9-12(10-23)18-21-16(2,3)17(4,5)22-18/h6-9,23H,10H2,1-5H3,(H,19,20) |
| InChIKey | LOVURHXLXRPISO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|