C14H22BNO2S2 — CID 170802552
3-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170802552) has the molecular formula C14H22BNO2S2 and a molecular weight of 311.28 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170802552 |
| Molecular Formula | C14H22BNO2S2 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | Cc1nc(C=C(CS)B2OC(C)(C)C(C)(C)O2)sc1C |
| InChI | InChI=1S/C14H22BNO2S2/c1-9-10(2)20-12(16-9)7-11(8-19)15-17-13(3,4)14(5,6)18-15/h7,19H,8H2,1-6H3 |
| InChIKey | AUPJHIUVQBIEAZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|