C19H25BN2O2S2 — CID 170803899
3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803899) has the molecular formula C19H25BN2O2S2 and a molecular weight of 388.37 g/mol. Its IUPAC name is 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803899 |
| Molecular Formula | C19H25BN2O2S2 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | Cc1sc(N)nc1-c1ccc(C=C(CS)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H25BN2O2S2/c1-12-16(22-17(21)26-12)14-8-6-13(7-9-14)10-15(11-25)20-23-18(2,3)19(4,5)24-20/h6-10,25H,11H2,1-5H3,(H2,21,22) |
| InChIKey | FXSQCYUUJOHIKE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|