C16H25BN2O2S — CID 170803039
3-(4,5-diamino-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803039) has the molecular formula C16H25BN2O2S and a molecular weight of 320.27 g/mol. Its IUPAC name is 3-(4,5-diamino-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(4,5-diamino-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803039 |
| Molecular Formula | C16H25BN2O2S |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-(4,5-diamino-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | Cc1cc(N)c(N)cc1C=C(CS)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H25BN2O2S/c1-10-6-13(18)14(19)8-11(10)7-12(9-22)17-20-15(2,3)16(4,5)21-17/h6-8,22H,9,18-19H2,1-5H3 |
| InChIKey | XXXSOYHOHQTHGD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|