C16H21BF3NO3S — CID 170803864
3-[2-amino-5-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803864) has the molecular formula C16H21BF3NO3S and a molecular weight of 375.22 g/mol. Its IUPAC name is 3-[2-amino-5-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-[2-amino-5-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803864 |
| Molecular Formula | C16H21BF3NO3S |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-[2-amino-5-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cc(OC(F)(F)F)ccc2N)CS)OC1(C)C |
| InChI | InChI=1S/C16H21BF3NO3S/c1-14(2)15(3,4)24-17(23-14)11(9-25)7-10-8-12(5-6-13(10)21)22-16(18,19)20/h5-8,25H,9,21H2,1-4H3 |
| InChIKey | DPRRKTIQLHWHKS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|