C18H22BBrF3NO4 — CID 170808960
N-[3-[2-bromo-4-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808960) has the molecular formula C18H22BBrF3NO4 and a molecular weight of 464.09 g/mol. Its IUPAC name is N-[3-[2-bromo-4-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-[2-bromo-4-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808960 |
| Molecular Formula | C18H22BBrF3NO4 |
| Molecular Weight | 464.09 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | N-[3-[2-bromo-4-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccc(OC(F)(F)F)cc1Br)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H22BBrF3NO4/c1-11(25)24-10-13(19-27-16(2,3)17(4,5)28-19)8-12-6-7-14(9-15(12)20)26-18(21,22)23/h6-9H,10H2,1-5H3,(H,24,25) |
| InChIKey | IIIPCNBXPWAWDM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.09 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|