C19H28BN3O5 — CID 170808737
N-[3-[2-(hydrazinecarbonyl)-4-methoxyphenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808737) has the molecular formula C19H28BN3O5 and a molecular weight of 389.26 g/mol. Its IUPAC name is N-[3-[2-(hydrazinecarbonyl)-4-methoxyphenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-[2-(hydrazinecarbonyl)-4-methoxyphenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808737 |
| Molecular Formula | C19H28BN3O5 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[3-[2-(hydrazinecarbonyl)-4-methoxyphenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | COc1ccc(C=C(CNC(C)=O)B2OC(C)(C)C(C)(C)O2)c(C(=O)NN)c1 |
| InChI | InChI=1S/C19H28BN3O5/c1-12(24)22-11-14(20-27-18(2,3)19(4,5)28-20)9-13-7-8-15(26-6)10-16(13)17(25)23-21/h7-10H,11,21H2,1-6H3,(H,22,24)(H,23,25) |
| InChIKey | OVGZLBVWVCOARU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|