C14H20BN3O4S — CID 170803512
3-amino-6-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazine-2-carboxylic acid (PubChem CID 170803512) has the molecular formula C14H20BN3O4S and a molecular weight of 337.21 g/mol. Its IUPAC name is 3-amino-6-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazine-2-carboxylic acid.
| Compound Name | 3-amino-6-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 170803512 |
| Molecular Formula | C14H20BN3O4S |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-amino-6-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazine-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2cnc(N)c(C(=O)O)n2)CS)OC1(C)C |
| InChI | InChI=1S/C14H20BN3O4S/c1-13(2)14(3,4)22-15(21-13)8(7-23)5-9-6-17-11(16)10(18-9)12(19)20/h5-6,23H,7H2,1-4H3,(H2,16,17)(H,19,20) |
| InChIKey | FHKBBJIZSDEYHY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|