C20H28BClN4O4 — CID 170809816
tert-butyl N-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809816) has the molecular formula C20H28BClN4O4 and a molecular weight of 434.73 g/mol. Its IUPAC name is tert-butyl N-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809816 |
| Molecular Formula | C20H28BClN4O4 |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | tert-butyl N-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cnc2ccc(Cl)nn12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H28BClN4O4/c1-18(2,3)28-17(27)24-11-13(21-29-19(4,5)20(6,7)30-21)10-14-12-23-16-9-8-15(22)25-26(14)16/h8-10,12H,11H2,1-7H3,(H,24,27) |
| InChIKey | NAZQWZVTRFLSEN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|