C8H6N4O5 — CID 23422189
1-methyl-2,4,6-trioxo-5H-pteridine-7-carboxylic acid (PubChem CID 23422189) has the molecular formula C8H6N4O5 and a molecular weight of 238.16 g/mol. Its IUPAC name is 1-methyl-2,4,6-trioxo-5H-pteridine-7-carboxylic acid.
| Compound Name | 1-methyl-2,4,6-trioxo-5H-pteridine-7-carboxylic acid |
|---|---|
| PubChem CID | 23422189 |
| Molecular Formula | C8H6N4O5 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 1-methyl-2,4,6-trioxo-5H-pteridine-7-carboxylic acid |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(=O)c(C(=O)O)nc21 |
| InChI | InChI=1S/C8H6N4O5/c1-12-4-2(5(13)11-8(12)17)10-6(14)3(9-4)7(15)16/h1H3,(H,10,14)(H,15,16)(H,11,13,17) |
| InChIKey | MFXMXJCPLDCVTQ-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |