C14H14N4O2 — CID 115925676
3-methyl-8-(2-phenylethyl)-7H-purine-2,6-dione (PubChem CID 115925676) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-methyl-8-(2-phenylethyl)-7H-purine-2,6-dione.
| Compound Name | 3-methyl-8-(2-phenylethyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115925676 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-methyl-8-(2-phenylethyl)-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(CCc3ccccc3)nc21 |
| InChI | InChI=1S/C14H14N4O2/c1-18-12-11(13(19)17-14(18)20)15-10(16-12)8-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,15,16)(H,17,19,20) |
| InChIKey | LTADPQIDVZMJCM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |