C14H14N6O3 — CID 47840262
3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-pyridin-2-ylpropanamide (PubChem CID 47840262) has the molecular formula C14H14N6O3 and a molecular weight of 314.31 g/mol. Its IUPAC name is 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-pyridin-2-ylpropanamide.
| Compound Name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 47840262 |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-pyridin-2-ylpropanamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(CCC(=O)Nc3ccccn3)nc21 |
| InChI | InChI=1S/C14H14N6O3/c1-20-12-11(13(22)19-14(20)23)17-9(18-12)5-6-10(21)16-8-4-2-3-7-15-8/h2-4,7H,5-6H2,1H3,(H,17,18)(H,15,16,21)(H,19,22,23) |
| InChIKey | RUBJHPASCNKKKJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |