C22H21N5O4 — CID 47780301
3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide (PubChem CID 47780301) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide.
| Compound Name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 47780301 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)CCc3nc4c([nH]3)c(=O)[nH]c(=O)n4C)cc2)c1 |
| InChI | InChI=1S/C22H21N5O4/c1-13-4-3-5-16(12-13)31-15-8-6-14(7-9-15)23-18(28)11-10-17-24-19-20(25-17)27(2)22(30)26-21(19)29/h3-9,12H,10-11H2,1-2H3,(H,23,28)(H,24,25)(H,26,29,30) |
| InChIKey | KESGQKPOFVIAIL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |