About 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide
3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide (PubChem CID 47780301) has the molecular formula C22H21N5O4
and a molecular weight of 419.44 g/mol. Its IUPAC name is 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide.
Molecular Properties
| Compound Name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide |
| PubChem CID | 47780301 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)CCc3nc4c([nH]3)c(=O)[nH]c(=O)n4C)cc2)c1 |
| InChI | InChI=1S/C22H21N5O4/c1-13-4-3-5-16(12-13)31-15-8-6-14(7-9-15)23-18(28)11-10-17-24-19-20(25-17)27(2)22(30)26-21(19)29/h3-9,12H,10-11H2,1-2H3,(H,23,28)(H,24,25)(H,26,29,30) |
| InChIKey | KESGQKPOFVIAIL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide?
The IUPAC name of 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide (CID 47780301) is 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide.
What is the SMILES notation for 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide?
The canonical SMILES for 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide is Cc1cccc(Oc2ccc(NC(=O)CCc3nc4c([nH]3)c(=O)[nH]c(=O)n4C)cc2)c1.
What is the InChIKey of 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide?
The InChIKey is KESGQKPOFVIAIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5O4/c1-13-4-3-5-16(12-13)31-15-8-6-14(7-9-15)23-18(28)11-10-17-24-19-20(25-17)27(2)22(30)26-21(19)29/h3-9,12H,10-11H2,1-2H3,(H,23,28)(H,24,25)(H,26,29,30).
What are the key properties of 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide?
3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide has a molecular weight of 419.44 g/mol, XLogP of 2.62, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-[4-(3-methylphenoxy)phenyl]propanamide is sourced from PubChem (CID 47780301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).