C23H23N5O3 — CID 56523672
N-(1,1-diphenylethyl)-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide (PubChem CID 56523672) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-(1,1-diphenylethyl)-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide.
| Compound Name | N-(1,1-diphenylethyl)-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide |
|---|---|
| PubChem CID | 56523672 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(1,1-diphenylethyl)-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(CCC(=O)NC(C)(c3ccccc3)c3ccccc3)nc21 |
| InChI | InChI=1S/C23H23N5O3/c1-23(15-9-5-3-6-10-15,16-11-7-4-8-12-16)27-18(29)14-13-17-24-19-20(25-17)28(2)22(31)26-21(19)30/h3-12H,13-14H2,1-2H3,(H,24,25)(H,27,29)(H,26,30,31) |
| InChIKey | CKTKTHNPBLPPRP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |