C12H17N5O4 — CID 129269697
tert-butyl N-[(3-methyl-2,6-dioxo-7H-purin-8-yl)methyl]carbamate (PubChem CID 129269697) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is tert-butyl N-[(3-methyl-2,6-dioxo-7H-purin-8-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-methyl-2,6-dioxo-7H-purin-8-yl)methyl]carbamate |
|---|---|
| PubChem CID | 129269697 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | tert-butyl N-[(3-methyl-2,6-dioxo-7H-purin-8-yl)methyl]carbamate |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(CNC(=O)OC(C)(C)C)nc21 |
| InChI | InChI=1S/C12H17N5O4/c1-12(2,3)21-11(20)13-5-6-14-7-8(15-6)17(4)10(19)16-9(7)18/h5H2,1-4H3,(H,13,20)(H,14,15)(H,16,18,19) |
| InChIKey | JPSMSOAOXFNTOJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |