C19H19N5O4 — CID 47781323
N-[1-(1-benzofuran-2-yl)ethyl]-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide (PubChem CID 47781323) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide |
|---|---|
| PubChem CID | 47781323 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide |
| SMILES | CC(NC(=O)CCc1nc2c([nH]1)c(=O)[nH]c(=O)n2C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H19N5O4/c1-10(13-9-11-5-3-4-6-12(11)28-13)20-15(25)8-7-14-21-16-17(22-14)24(2)19(27)23-18(16)26/h3-6,9-10H,7-8H2,1-2H3,(H,20,25)(H,21,22)(H,23,26,27) |
| InChIKey | XRMIXMNAIBTODY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |