C16H18N4O3 — CID 158817113
8-[2-(4-methoxyphenyl)ethyl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 158817113) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 8-[2-(4-methoxyphenyl)ethyl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[2-(4-methoxyphenyl)ethyl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 158817113 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 8-[2-(4-methoxyphenyl)ethyl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | COc1ccc(CCc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C16H18N4O3/c1-19-14-13(15(21)20(2)16(19)22)17-12(18-14)9-6-10-4-7-11(23-3)8-5-10/h4-5,7-8H,6,9H2,1-3H3,(H,17,18) |
| InChIKey | WPFMRBBYPXFRFY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |