C15H17N5O3 — CID 1493345
8-[(3-methoxyphenyl)methylamino]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 1493345) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 8-[(3-methoxyphenyl)methylamino]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[(3-methoxyphenyl)methylamino]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 1493345 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 8-[(3-methoxyphenyl)methylamino]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | COc1cccc(CNc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C15H17N5O3/c1-19-12-11(13(21)20(2)15(19)22)17-14(18-12)16-8-9-5-4-6-10(7-9)23-3/h4-7H,8H2,1-3H3,(H2,16,17,18) |
| InChIKey | QEAFODNOVJGIJM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |