C12H13N5O2S — CID 1493334
1,3-dimethyl-8-(thiophen-2-ylmethylamino)-7H-purine-2,6-dione (PubChem CID 1493334) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 1,3-dimethyl-8-(thiophen-2-ylmethylamino)-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(thiophen-2-ylmethylamino)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 1493334 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1,3-dimethyl-8-(thiophen-2-ylmethylamino)-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCc3cccs3)nc2n(C)c1=O |
| InChI | InChI=1S/C12H13N5O2S/c1-16-9-8(10(18)17(2)12(16)19)14-11(15-9)13-6-7-4-3-5-20-7/h3-5H,6H2,1-2H3,(H2,13,14,15) |
| InChIKey | NXTGUIARUDAJOG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |