C13H14N6O2 — CID 30049858
1,3-dimethyl-8-(pyridin-4-ylmethylamino)-7H-purine-2,6-dione (PubChem CID 30049858) has the molecular formula C13H14N6O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1,3-dimethyl-8-(pyridin-4-ylmethylamino)-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(pyridin-4-ylmethylamino)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 30049858 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1,3-dimethyl-8-(pyridin-4-ylmethylamino)-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCc3ccncc3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H14N6O2/c1-18-10-9(11(20)19(2)13(18)21)16-12(17-10)15-7-8-3-5-14-6-4-8/h3-6H,7H2,1-2H3,(H2,15,16,17) |
| InChIKey | LJRQNEQGYSQQOU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |