C13H19N5O3 — CID 63711378
1,3-dimethyl-8-(oxan-4-ylmethylamino)-7H-purine-2,6-dione (PubChem CID 63711378) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1,3-dimethyl-8-(oxan-4-ylmethylamino)-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(oxan-4-ylmethylamino)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 63711378 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1,3-dimethyl-8-(oxan-4-ylmethylamino)-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCC3CCOCC3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H19N5O3/c1-17-10-9(11(19)18(2)13(17)20)15-12(16-10)14-7-8-3-5-21-6-4-8/h8H,3-7H2,1-2H3,(H2,14,15,16) |
| InChIKey | AJLHZZWPSRKCIU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |