C14H14ClN5O2 — CID 1493329
8-[(2-chlorophenyl)methylamino]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 1493329) has the molecular formula C14H14ClN5O2 and a molecular weight of 319.75 g/mol. Its IUPAC name is 8-[(2-chlorophenyl)methylamino]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[(2-chlorophenyl)methylamino]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 1493329 |
| Molecular Formula | C14H14ClN5O2 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 8-[(2-chlorophenyl)methylamino]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCc3ccccc3Cl)nc2n(C)c1=O |
| InChI | InChI=1S/C14H14ClN5O2/c1-19-11-10(12(21)20(2)14(19)22)17-13(18-11)16-7-8-5-3-4-6-9(8)15/h3-6H,7H2,1-2H3,(H2,16,17,18) |
| InChIKey | FCYVTTBVLUGVFN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |