C12H20N6O2 — CID 107323631
8-(5-aminopentylamino)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 107323631) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 8-(5-aminopentylamino)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(5-aminopentylamino)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 107323631 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 8-(5-aminopentylamino)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCCCCCN)nc2n(C)c1=O |
| InChI | InChI=1S/C12H20N6O2/c1-17-9-8(10(19)18(2)12(17)20)15-11(16-9)14-7-5-3-4-6-13/h3-7,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | JFMZUKCYNSOUMY-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|