About 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione
1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione (PubChem CID 114794596) has the molecular formula C13H20N6O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione |
| PubChem CID | 114794596 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCCC3CCCN3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H20N6O2/c1-18-10-9(11(20)19(2)13(18)21)16-12(17-10)15-7-5-8-4-3-6-14-8/h8,14H,3-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | BWFDTBCTURQZCD-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione?
The IUPAC name of 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione (CID 114794596) is 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione.
What is the SMILES notation for 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione?
The canonical SMILES for 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione is Cn1c(=O)c2[nH]c(NCCC3CCCN3)nc2n(C)c1=O.
What is the InChIKey of 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione?
The InChIKey is BWFDTBCTURQZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O2/c1-18-10-9(11(20)19(2)13(18)21)16-12(17-10)15-7-5-8-4-3-6-14-8/h8,14H,3-7H2,1-2H3,(H2,15,16,17).
What are the key properties of 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione?
1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione has a molecular weight of 292.34 g/mol, XLogP of -0.49, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione is sourced from PubChem (CID 114794596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).