C13H20N6O2 — CID 114794596
1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione (PubChem CID 114794596) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 114794596 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1,3-dimethyl-8-(2-pyrrolidin-2-ylethylamino)-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCCC3CCCN3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H20N6O2/c1-18-10-9(11(20)19(2)13(18)21)16-12(17-10)15-7-5-8-4-3-6-14-8/h8,14H,3-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | BWFDTBCTURQZCD-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |