C12H17N5O2 — CID 24846510
1,3-dimethyl-8-piperidin-3-yl-7H-purine-2,6-dione (PubChem CID 24846510) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1,3-dimethyl-8-piperidin-3-yl-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-piperidin-3-yl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 24846510 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1,3-dimethyl-8-piperidin-3-yl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(C3CCCNC3)nc2n(C)c1=O |
| InChI | InChI=1S/C12H17N5O2/c1-16-10-8(11(18)17(2)12(16)19)14-9(15-10)7-4-3-5-13-6-7/h7,13H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | KNDRPZBPQHHAPT-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |