C18H27N5O4 — CID 66723971
tert-butyl N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)cyclohexyl]carbamate (PubChem CID 66723971) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is tert-butyl N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 66723971 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | tert-butyl N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)cyclohexyl]carbamate |
| SMILES | Cn1c(=O)c2[nH]c(C3CCCC(NC(=O)OC(C)(C)C)C3)nc2n(C)c1=O |
| InChI | InChI=1S/C18H27N5O4/c1-18(2,3)27-16(25)19-11-8-6-7-10(9-11)13-20-12-14(21-13)22(4)17(26)23(5)15(12)24/h10-11H,6-9H2,1-5H3,(H,19,25)(H,20,21) |
| InChIKey | PRPZZMCTMRVDCY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |