C22H34N6O4 — CID 67041551
tert-butyl N-[(1S,3R)-3-[[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]amino]cyclopentyl]carbamate (PubChem CID 67041551) has the molecular formula C22H34N6O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 67041551 |
| Molecular Formula | C22H34N6O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]amino]cyclopentyl]carbamate |
| SMILES | CC(C)=CCn1c(N[C@@H]2CC[C@H](NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C22H34N6O4/c1-13(2)10-11-28-16-17(26(6)21(31)27(7)18(16)29)25-19(28)23-14-8-9-15(12-14)24-20(30)32-22(3,4)5/h10,14-15H,8-9,11-12H2,1-7H3,(H,23,25)(H,24,30)/t14-,15+/m1/s1 |
| InChIKey | YKXHTGWCHISXTF-CABCVRRESA-N |
| XLogP | 2.26 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|