C23H35N5O4 — CID 66723769
tert-butyl N-[3-[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]cyclohexyl]carbamate (PubChem CID 66723769) has the molecular formula C23H35N5O4 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl N-[3-[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 66723769 |
| Molecular Formula | C23H35N5O4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | tert-butyl N-[3-[1,3-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]cyclohexyl]carbamate |
| SMILES | CC(C)=CCn1c(C2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H35N5O4/c1-14(2)11-12-28-17-19(26(6)22(31)27(7)20(17)29)25-18(28)15-9-8-10-16(13-15)24-21(30)32-23(3,4)5/h11,15-16H,8-10,12-13H2,1-7H3,(H,24,30) |
| InChIKey | HZFJIGLHVCOVAK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|